C23H20F3NO3 — CID 89444161
2-[2-ethyl-4-fluoro-3-[2-fluoro-5-(3-fluorophenyl)-N-methylanilino]phenoxy]acetic acid (PubChem CID 89444161) has the molecular formula C23H20F3NO3 and a molecular weight of 415.41 g/mol. Its IUPAC name is 2-[2-ethyl-4-fluoro-3-[2-fluoro-5-(3-fluorophenyl)-N-methylanilino]phenoxy]acetic acid.
| Compound Name | 2-[2-ethyl-4-fluoro-3-[2-fluoro-5-(3-fluorophenyl)-N-methylanilino]phenoxy]acetic acid |
|---|---|
| PubChem CID | 89444161 |
| Molecular Formula | C23H20F3NO3 |
| Molecular Weight | 415.41 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | 2-[2-ethyl-4-fluoro-3-[2-fluoro-5-(3-fluorophenyl)-N-methylanilino]phenoxy]acetic acid |
| SMILES | CCc1c(OCC(=O)O)ccc(F)c1N(C)c1cc(-c2cccc(F)c2)ccc1F |
| InChI | InChI=1S/C23H20F3NO3/c1-3-17-21(30-13-22(28)29)10-9-19(26)23(17)27(2)20-12-15(7-8-18(20)25)14-5-4-6-16(24)11-14/h4-12H,3,13H2,1-2H3,(H,28,29) |
| InChIKey | FYWQURHOGPYSIK-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.41 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |