C21H16F3NO4 — CID 89443598
2-[2,4-difluoro-3-[[5-(3-fluorophenyl)-2-hydroxyphenyl]methylamino]phenoxy]acetic acid (PubChem CID 89443598) has the molecular formula C21H16F3NO4 and a molecular weight of 403.36 g/mol. Its IUPAC name is 2-[2,4-difluoro-3-[[5-(3-fluorophenyl)-2-hydroxyphenyl]methylamino]phenoxy]acetic acid.
| Compound Name | 2-[2,4-difluoro-3-[[5-(3-fluorophenyl)-2-hydroxyphenyl]methylamino]phenoxy]acetic acid |
|---|---|
| PubChem CID | 89443598 |
| Molecular Formula | C21H16F3NO4 |
| Molecular Weight | 403.36 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | 2-[2,4-difluoro-3-[[5-(3-fluorophenyl)-2-hydroxyphenyl]methylamino]phenoxy]acetic acid |
| SMILES | O=C(O)COc1ccc(F)c(NCc2cc(-c3cccc(F)c3)ccc2O)c1F |
| InChI | InChI=1S/C21H16F3NO4/c22-15-3-1-2-12(9-15)13-4-6-17(26)14(8-13)10-25-21-16(23)5-7-18(20(21)24)29-11-19(27)28/h1-9,25-26H,10-11H2,(H,27,28) |
| InChIKey | OTPSRJSSABFALD-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.36 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|