C22H19F2NO3 — CID 89444032
2-[3-[[2-fluoro-5-(3-fluorophenyl)-3-methylphenyl]methylamino]phenoxy]acetic acid (PubChem CID 89444032) has the molecular formula C22H19F2NO3 and a molecular weight of 383.39 g/mol. Its IUPAC name is 2-[3-[[2-fluoro-5-(3-fluorophenyl)-3-methylphenyl]methylamino]phenoxy]acetic acid.
| Compound Name | 2-[3-[[2-fluoro-5-(3-fluorophenyl)-3-methylphenyl]methylamino]phenoxy]acetic acid |
|---|---|
| PubChem CID | 89444032 |
| Molecular Formula | C22H19F2NO3 |
| Molecular Weight | 383.39 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | 2-[3-[[2-fluoro-5-(3-fluorophenyl)-3-methylphenyl]methylamino]phenoxy]acetic acid |
| SMILES | Cc1cc(-c2cccc(F)c2)cc(CNc2cccc(OCC(=O)O)c2)c1F |
| InChI | InChI=1S/C22H19F2NO3/c1-14-8-16(15-4-2-5-18(23)10-15)9-17(22(14)24)12-25-19-6-3-7-20(11-19)28-13-21(26)27/h2-11,25H,12-13H2,1H3,(H,26,27) |
| InChIKey | URRDVLVLRJSDAH-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.39 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |