C21H29FN6 — CID 89444922
6-[4-[1-(4-fluorophenyl)-2-piperidin-1-ylethyl]piperazin-1-yl]pyrimidin-4-amine (PubChem CID 89444922) has the molecular formula C21H29FN6 and a molecular weight of 384.50 g/mol. Its IUPAC name is 6-[4-[1-(4-fluorophenyl)-2-piperidin-1-ylethyl]piperazin-1-yl]pyrimidin-4-amine.
| Compound Name | 6-[4-[1-(4-fluorophenyl)-2-piperidin-1-ylethyl]piperazin-1-yl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 89444922 |
| Molecular Formula | C21H29FN6 |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.24 |
| IUPAC Name | 6-[4-[1-(4-fluorophenyl)-2-piperidin-1-ylethyl]piperazin-1-yl]pyrimidin-4-amine |
| SMILES | Nc1cc(N2CCN(C(CN3CCCCC3)c3ccc(F)cc3)CC2)ncn1 |
| InChI | InChI=1S/C21H29FN6/c22-18-6-4-17(5-7-18)19(15-26-8-2-1-3-9-26)27-10-12-28(13-11-27)21-14-20(23)24-16-25-21/h4-7,14,16,19H,1-3,8-13,15H2,(H2,23,24,25) |
| InChIKey | YBTRLRWHXNZKMS-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 61.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |