C8H16N3PS — CID 89445785
4-ethynyl-N,N,1,3-tetramethyl-2-sulfanylidene-1,3,2λ5-diazaphospholidin-2-amine (PubChem CID 89445785) has the molecular formula C8H16N3PS and a molecular weight of 217.28 g/mol. Its IUPAC name is 4-ethynyl-N,N,1,3-tetramethyl-2-sulfanylidene-1,3,2λ5-diazaphospholidin-2-amine.
| Compound Name | 4-ethynyl-N,N,1,3-tetramethyl-2-sulfanylidene-1,3,2λ5-diazaphospholidin-2-amine |
|---|---|
| PubChem CID | 89445785 |
| Molecular Formula | C8H16N3PS |
| Molecular Weight | 217.28 g/mol |
| Exact Mass | 217.08 |
| IUPAC Name | 4-ethynyl-N,N,1,3-tetramethyl-2-sulfanylidene-1,3,2λ5-diazaphospholidin-2-amine |
| SMILES | C#CC1CN(C)P(=S)(N(C)C)N1C |
| InChI | InChI=1S/C8H16N3PS/c1-6-8-7-10(4)12(13,9(2)3)11(8)5/h1,8H,7H2,2-5H3 |
| InChIKey | ZJVDMKDZHFWHTM-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.28 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|