C7H12N2S3 — CID 89446157
4-ethynyl-2,6-dimethyl-1,1-bis(sulfanylidene)-1,2,6-thiadiazinane (PubChem CID 89446157) has the molecular formula C7H12N2S3 and a molecular weight of 220.39 g/mol. Its IUPAC name is 4-ethynyl-2,6-dimethyl-1,1-bis(sulfanylidene)-1,2,6-thiadiazinane.
| Compound Name | 4-ethynyl-2,6-dimethyl-1,1-bis(sulfanylidene)-1,2,6-thiadiazinane |
|---|---|
| PubChem CID | 89446157 |
| Molecular Formula | C7H12N2S3 |
| Molecular Weight | 220.39 g/mol |
| Exact Mass | 220.02 |
| IUPAC Name | 4-ethynyl-2,6-dimethyl-1,1-bis(sulfanylidene)-1,2,6-thiadiazinane |
| SMILES | C#CC1CN(C)S(=S)(=S)N(C)C1 |
| InChI | InChI=1S/C7H12N2S3/c1-4-7-5-8(2)12(10,11)9(3)6-7/h1,7H,5-6H2,2-3H3 |
| InChIKey | BRJQXDGGENPDQY-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.39 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|