C7H9NS2 — CID 88889698
5-ethynyl-3-methyl-1,3-thiazinane-2-thione (PubChem CID 88889698) has the molecular formula C7H9NS2 and a molecular weight of 171.29 g/mol. Its IUPAC name is 5-ethynyl-3-methyl-1,3-thiazinane-2-thione.
| Compound Name | 5-ethynyl-3-methyl-1,3-thiazinane-2-thione |
|---|---|
| PubChem CID | 88889698 |
| Molecular Formula | C7H9NS2 |
| Molecular Weight | 171.29 g/mol |
| Exact Mass | 171.02 |
| IUPAC Name | 5-ethynyl-3-methyl-1,3-thiazinane-2-thione |
| SMILES | C#CC1CSC(=S)N(C)C1 |
| InChI | InChI=1S/C7H9NS2/c1-3-6-4-8(2)7(9)10-5-6/h1,6H,4-5H2,2H3 |
| InChIKey | QIEXYPLUTJTTII-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.29 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|