C9H17NS2 — CID 129105778
(4R)-3,4-di(propan-2-yl)-1,3-thiazolidine-2-thione (PubChem CID 129105778) has the molecular formula C9H17NS2 and a molecular weight of 203.38 g/mol. Its IUPAC name is (4R)-3,4-di(propan-2-yl)-1,3-thiazolidine-2-thione.
| Compound Name | (4R)-3,4-di(propan-2-yl)-1,3-thiazolidine-2-thione |
|---|---|
| PubChem CID | 129105778 |
| Molecular Formula | C9H17NS2 |
| Molecular Weight | 203.38 g/mol |
| Exact Mass | 203.08 |
| IUPAC Name | (4R)-3,4-di(propan-2-yl)-1,3-thiazolidine-2-thione |
| SMILES | CC(C)[C@@H]1CSC(=S)N1C(C)C |
| InChI | InChI=1S/C9H17NS2/c1-6(2)8-5-12-9(11)10(8)7(3)4/h6-8H,5H2,1-4H3/t8-/m0/s1 |
| InChIKey | RLGHIMQYUHDOOL-QMMMGPOBSA-N |
| XLogP | 2.75 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.38 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|