About 5-ethynyl-4,6-dimethyltrithiane 2-oxide
5-ethynyl-4,6-dimethyltrithiane 2-oxide (PubChem CID 89446446) has the molecular formula C7H10OS3
and a molecular weight of 206.36 g/mol. Its IUPAC name is 5-ethynyl-4,6-dimethyltrithiane 2-oxide.
Molecular Properties
| Compound Name | 5-ethynyl-4,6-dimethyltrithiane 2-oxide |
| PubChem CID | 89446446 |
| Molecular Formula | C7H10OS3 |
| Molecular Weight | 206.36 g/mol |
| Exact Mass | 205.99 |
| IUPAC Name | 5-ethynyl-4,6-dimethyltrithiane 2-oxide |
| SMILES | C#CC1C(C)SS(=O)SC1C |
| InChI | InChI=1S/C7H10OS3/c1-4-7-5(2)9-11(8)10-6(7)3/h1,5-7H,2-3H3 |
| InChIKey | SISGZEWVPUKRKY-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.36 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-ethynyl-4,6-dimethyltrithiane 2-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethynyl-4,6-dimethyltrithiane 2-oxide?
The IUPAC name of 5-ethynyl-4,6-dimethyltrithiane 2-oxide (CID 89446446) is 5-ethynyl-4,6-dimethyltrithiane 2-oxide.
What is the SMILES notation for 5-ethynyl-4,6-dimethyltrithiane 2-oxide?
The canonical SMILES for 5-ethynyl-4,6-dimethyltrithiane 2-oxide is C#CC1C(C)SS(=O)SC1C.
What is the InChIKey of 5-ethynyl-4,6-dimethyltrithiane 2-oxide?
The InChIKey is SISGZEWVPUKRKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10OS3/c1-4-7-5(2)9-11(8)10-6(7)3/h1,5-7H,2-3H3.
What are the key properties of 5-ethynyl-4,6-dimethyltrithiane 2-oxide?
5-ethynyl-4,6-dimethyltrithiane 2-oxide has a molecular weight of 206.36 g/mol, XLogP of 2.07, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethynyl-4,6-dimethyltrithiane 2-oxide is sourced from PubChem (CID 89446446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).