C9H13N2PS2 — CID 89446663
4,5-diethynyl-N,N,3-trimethyl-2-sulfanylidene-1,3,2λ5-thiazaphospholidin-2-amine (PubChem CID 89446663) has the molecular formula C9H13N2PS2 and a molecular weight of 244.33 g/mol. Its IUPAC name is 4,5-diethynyl-N,N,3-trimethyl-2-sulfanylidene-1,3,2λ5-thiazaphospholidin-2-amine.
| Compound Name | 4,5-diethynyl-N,N,3-trimethyl-2-sulfanylidene-1,3,2λ5-thiazaphospholidin-2-amine |
|---|---|
| PubChem CID | 89446663 |
| Molecular Formula | C9H13N2PS2 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.03 |
| IUPAC Name | 4,5-diethynyl-N,N,3-trimethyl-2-sulfanylidene-1,3,2λ5-thiazaphospholidin-2-amine |
| SMILES | C#CC1SP(=S)(N(C)C)N(C)C1C#C |
| InChI | InChI=1S/C9H13N2PS2/c1-6-8-9(7-2)14-12(13,10(3)4)11(8)5/h1-2,8-9H,3-5H3 |
| InChIKey | POJBTFYKDNOEJX-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|