C25H25N5O — CID 8944723
(E)-N-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]-3-(1-phenylpyrazol-4-yl)prop-2-enamide (PubChem CID 8944723) has the molecular formula C25H25N5O and a molecular weight of 411.51 g/mol. Its IUPAC name is (E)-N-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]-3-(1-phenylpyrazol-4-yl)prop-2-enamide.
| Compound Name | (E)-N-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]-3-(1-phenylpyrazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 8944723 |
| Molecular Formula | C25H25N5O |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.21 |
| IUPAC Name | (E)-N-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]-3-(1-phenylpyrazol-4-yl)prop-2-enamide |
| SMILES | Cc1nn(Cc2ccccc2)c(C)c1CNC(=O)/C=C/c1cnn(-c2ccccc2)c1 |
| InChI | InChI=1S/C25H25N5O/c1-19-24(20(2)29(28-19)17-21-9-5-3-6-10-21)16-26-25(31)14-13-22-15-27-30(18-22)23-11-7-4-8-12-23/h3-15,18H,16-17H2,1-2H3,(H,26,31)/b14-13+ |
| InChIKey | QPSQNJXZOHSBEZ-BUHFOSPRSA-N |
| XLogP | 4.06 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|