C27H25N5O2 — CID 75895788
N-[[3-[(3-methylphenyl)carbamoylamino]phenyl]methyl]-3-(1-phenylpyrazol-4-yl)prop-2-enamide (PubChem CID 75895788) has the molecular formula C27H25N5O2 and a molecular weight of 451.53 g/mol. Its IUPAC name is N-[[3-[(3-methylphenyl)carbamoylamino]phenyl]methyl]-3-(1-phenylpyrazol-4-yl)prop-2-enamide.
| Compound Name | N-[[3-[(3-methylphenyl)carbamoylamino]phenyl]methyl]-3-(1-phenylpyrazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 75895788 |
| Molecular Formula | C27H25N5O2 |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.20 |
| IUPAC Name | N-[[3-[(3-methylphenyl)carbamoylamino]phenyl]methyl]-3-(1-phenylpyrazol-4-yl)prop-2-enamide |
| SMILES | Cc1cccc(NC(=O)Nc2cccc(CNC(=O)C=Cc3cnn(-c4ccccc4)c3)c2)c1 |
| InChI | InChI=1S/C27H25N5O2/c1-20-7-5-9-23(15-20)30-27(34)31-24-10-6-8-21(16-24)17-28-26(33)14-13-22-18-29-32(19-22)25-11-3-2-4-12-25/h2-16,18-19H,17H2,1H3,(H,28,33)(H2,30,31,34) |
| InChIKey | CFBDYQLZIVEYDW-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 88.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|