C22H21N5O2 — CID 167908329
(E)-N-[[3-[(3-methylphenyl)carbamoylamino]phenyl]methyl]-3-pyrazin-2-ylprop-2-enamide (PubChem CID 167908329) has the molecular formula C22H21N5O2 and a molecular weight of 387.44 g/mol. Its IUPAC name is (E)-N-[[3-[(3-methylphenyl)carbamoylamino]phenyl]methyl]-3-pyrazin-2-ylprop-2-enamide.
| Compound Name | (E)-N-[[3-[(3-methylphenyl)carbamoylamino]phenyl]methyl]-3-pyrazin-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 167908329 |
| Molecular Formula | C22H21N5O2 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | (E)-N-[[3-[(3-methylphenyl)carbamoylamino]phenyl]methyl]-3-pyrazin-2-ylprop-2-enamide |
| SMILES | Cc1cccc(NC(=O)Nc2cccc(CNC(=O)/C=C/c3cnccn3)c2)c1 |
| InChI | InChI=1S/C22H21N5O2/c1-16-4-2-6-18(12-16)26-22(29)27-19-7-3-5-17(13-19)14-25-21(28)9-8-20-15-23-10-11-24-20/h2-13,15H,14H2,1H3,(H,25,28)(H2,26,27,29)/b9-8+ |
| InChIKey | CESCBDHNCHKKKG-CMDGGOBGSA-N |
| XLogP | 3.76 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|