C21H19N3OS2 — CID 27163859
(E)-N-[3-(1,3-dithiolan-2-yl)phenyl]-3-(1-phenylpyrazol-4-yl)prop-2-enamide (PubChem CID 27163859) has the molecular formula C21H19N3OS2 and a molecular weight of 393.54 g/mol. Its IUPAC name is (E)-N-[3-(1,3-dithiolan-2-yl)phenyl]-3-(1-phenylpyrazol-4-yl)prop-2-enamide.
| Compound Name | (E)-N-[3-(1,3-dithiolan-2-yl)phenyl]-3-(1-phenylpyrazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 27163859 |
| Molecular Formula | C21H19N3OS2 |
| Molecular Weight | 393.54 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | (E)-N-[3-(1,3-dithiolan-2-yl)phenyl]-3-(1-phenylpyrazol-4-yl)prop-2-enamide |
| SMILES | O=C(/C=C/c1cnn(-c2ccccc2)c1)Nc1cccc(C2SCCS2)c1 |
| InChI | InChI=1S/C21H19N3OS2/c25-20(23-18-6-4-5-17(13-18)21-26-11-12-27-21)10-9-16-14-22-24(15-16)19-7-2-1-3-8-19/h1-10,13-15,21H,11-12H2,(H,23,25)/b10-9+ |
| InChIKey | HUVVBTSRUATLLS-MDZDMXLPSA-N |
| XLogP | 5.00 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.54 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|