C27H23N7O2 — CID 89447538
N-(3,5-dimethoxyphenyl)-3-(1-methylpyrazol-4-yl)-N-(3-pyrimidin-2-ylprop-2-ynyl)quinoxalin-6-amine (PubChem CID 89447538) has the molecular formula C27H23N7O2 and a molecular weight of 477.53 g/mol. Its IUPAC name is N-(3,5-dimethoxyphenyl)-3-(1-methylpyrazol-4-yl)-N-(3-pyrimidin-2-ylprop-2-ynyl)quinoxalin-6-amine.
| Compound Name | N-(3,5-dimethoxyphenyl)-3-(1-methylpyrazol-4-yl)-N-(3-pyrimidin-2-ylprop-2-ynyl)quinoxalin-6-amine |
|---|---|
| PubChem CID | 89447538 |
| Molecular Formula | C27H23N7O2 |
| Molecular Weight | 477.53 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | N-(3,5-dimethoxyphenyl)-3-(1-methylpyrazol-4-yl)-N-(3-pyrimidin-2-ylprop-2-ynyl)quinoxalin-6-amine |
| SMILES | COc1cc(OC)cc(N(CC#Cc2ncccn2)c2ccc3ncc(-c4cnn(C)c4)nc3c2)c1 |
| InChI | InChI=1S/C27H23N7O2/c1-33-18-19(16-31-33)26-17-30-24-8-7-20(14-25(24)32-26)34(11-4-6-27-28-9-5-10-29-27)21-12-22(35-2)15-23(13-21)36-3/h5,7-10,12-18H,11H2,1-3H3 |
| InChIKey | UWOKNQXHVAKWCJ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 91.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.53 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|