C27H36N2O4 — CID 89448763
2-(6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl)-3-ethyl-10-methoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-9-ol (PubChem CID 89448763) has the molecular formula C27H36N2O4 and a molecular weight of 452.60 g/mol. Its IUPAC name is 2-(6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl)-3-ethyl-10-methoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-9-ol.
| Compound Name | 2-(6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl)-3-ethyl-10-methoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-9-ol |
|---|---|
| PubChem CID | 89448763 |
| Molecular Formula | C27H36N2O4 |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.27 |
| IUPAC Name | 2-(6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl)-3-ethyl-10-methoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-9-ol |
| SMILES | CCC1CN2CCc3cc(O)c(OC)cc3C2CC1C1NCCc2cc(OC)c(OC)cc21 |
| InChI | InChI=1S/C27H36N2O4/c1-5-16-15-29-9-7-18-10-23(30)24(31-2)13-19(18)22(29)12-20(16)27-21-14-26(33-4)25(32-3)11-17(21)6-8-28-27/h10-11,13-14,16,20,22,27-28,30H,5-9,12,15H2,1-4H3 |
| InChIKey | WBHVYAWHHKMZFH-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 63.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |