C30H40N2O6 — CID 130192592
4-(3-ethyl-9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl)-7,8-dimethoxy-1,2,4,5-tetrahydro-3-benzazepine-3-carboxylic acid (PubChem CID 130192592) has the molecular formula C30H40N2O6 and a molecular weight of 524.66 g/mol. Its IUPAC name is 4-(3-ethyl-9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl)-7,8-dimethoxy-1,2,4,5-tetrahydro-3-benzazepine-3-carboxylic acid.
| Compound Name | 4-(3-ethyl-9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl)-7,8-dimethoxy-1,2,4,5-tetrahydro-3-benzazepine-3-carboxylic acid |
|---|---|
| PubChem CID | 130192592 |
| Molecular Formula | C30H40N2O6 |
| Molecular Weight | 524.66 g/mol |
| Exact Mass | 524.29 |
| IUPAC Name | 4-(3-ethyl-9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl)-7,8-dimethoxy-1,2,4,5-tetrahydro-3-benzazepine-3-carboxylic acid |
| SMILES | CCC1CN2CCc3cc(OC)c(OC)cc3C2CC1C1Cc2cc(OC)c(OC)cc2CCN1C(=O)O |
| InChI | InChI=1S/C30H40N2O6/c1-6-18-17-31-9-7-20-13-27(36-3)29(38-5)16-23(20)24(31)15-22(18)25-11-21-14-28(37-4)26(35-2)12-19(21)8-10-32(25)30(33)34/h12-14,16,18,22,24-25H,6-11,15,17H2,1-5H3,(H,33,34) |
| InChIKey | SQEOZIBDGVDCMI-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 80.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.66 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |