C38H49N3O5S — CID 137414803
4-(3-ethyl-9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl)-7,8-dimethoxy-N-[(4-methoxyphenyl)methyl]-1,2,4,5-tetrahydro-3-benzazepine-3-carbothioamide (PubChem CID 137414803) has the molecular formula C38H49N3O5S and a molecular weight of 659.89 g/mol. Its IUPAC name is 4-(3-ethyl-9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl)-7,8-dimethoxy-N-[(4-methoxyphenyl)methyl]-1,2,4,5-tetrahydro-3-benzazepine-3-carbothioamide.
| Compound Name | 4-(3-ethyl-9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl)-7,8-dimethoxy-N-[(4-methoxyphenyl)methyl]-1,2,4,5-tetrahydro-3-benzazepine-3-carbothioamide |
|---|---|
| PubChem CID | 137414803 |
| Molecular Formula | C38H49N3O5S |
| Molecular Weight | 659.89 g/mol |
| Exact Mass | 659.34 |
| IUPAC Name | 4-(3-ethyl-9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl)-7,8-dimethoxy-N-[(4-methoxyphenyl)methyl]-1,2,4,5-tetrahydro-3-benzazepine-3-carbothioamide |
| SMILES | CCC1CN2CCc3cc(OC)c(OC)cc3C2CC1C1Cc2cc(OC)c(OC)cc2CCN1C(=S)NCc1ccc(OC)cc1 |
| InChI | InChI=1S/C38H49N3O5S/c1-7-25-23-40-14-12-27-18-35(44-4)37(46-6)21-31(27)32(40)20-30(25)33-16-28-19-36(45-5)34(43-3)17-26(28)13-15-41(33)38(47)39-22-24-8-10-29(42-2)11-9-24/h8-11,17-19,21,25,30,32-33H,7,12-16,20,22-23H2,1-6H3,(H,39,47) |
| InChIKey | LPQUHWRUPZQHJA-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 64.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.89 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|