C37H46ClN3O4S — CID 78075739
N-[(4-chlorophenyl)methyl]-1-[(3-ethyl-9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl)methyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinoline-2-carbothioamide (PubChem CID 78075739) has the molecular formula C37H46ClN3O4S and a molecular weight of 664.31 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-1-[(3-ethyl-9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl)methyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinoline-2-carbothioamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-1-[(3-ethyl-9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl)methyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinoline-2-carbothioamide |
|---|---|
| PubChem CID | 78075739 |
| Molecular Formula | C37H46ClN3O4S |
| Molecular Weight | 664.31 g/mol |
| Exact Mass | 663.29 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-1-[(3-ethyl-9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl)methyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinoline-2-carbothioamide |
| SMILES | CCC1CN2CCc3cc(OC)c(OC)cc3C2CC1CC1c2cc(OC)c(OC)cc2CCN1C(=S)NCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C37H46ClN3O4S/c1-6-24-22-40-13-11-25-17-33(42-2)35(44-4)19-29(25)31(40)15-27(24)16-32-30-20-36(45-5)34(43-3)18-26(30)12-14-41(32)37(46)39-21-23-7-9-28(38)10-8-23/h7-10,17-20,24,27,31-32H,6,11-16,21-22H2,1-5H3,(H,39,46) |
| InChIKey | HVOHLZRJSNDUAD-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 55.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.31 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|