C30H39N2NaO4S2 — CID 71458904
sodium (1R)-1-[[(2R,3R,11bS)-3-ethyl-9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl]methyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinoline-2-carbodithioate (PubChem CID 71458904) has the molecular formula C30H39N2NaO4S2 and a molecular weight of 578.78 g/mol. Its IUPAC name is sodium (1R)-1-[[(2R,3R,11bS)-3-ethyl-9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl]methyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinoline-2-carbodithioate.
| Compound Name | sodium (1R)-1-[[(2R,3R,11bS)-3-ethyl-9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl]methyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinoline-2-carbodithioate |
|---|---|
| PubChem CID | 71458904 |
| Molecular Formula | C30H39N2NaO4S2 |
| Molecular Weight | 578.78 g/mol |
| Exact Mass | 578.22 |
| IUPAC Name | sodium (1R)-1-[[(2R,3R,11bS)-3-ethyl-9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl]methyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinoline-2-carbodithioate |
| SMILES | CC[C@H]1CN2CCc3cc(OC)c(OC)cc3[C@@H]2C[C@@H]1C[C@@H]1c2cc(OC)c(OC)cc2CCN1C(=S)[S-].[Na+] |
| InChI | InChI=1S/C30H40N2O4S2.Na/c1-6-18-17-31-9-7-19-13-26(33-2)28(35-4)15-22(19)24(31)11-21(18)12-25-23-16-29(36-5)27(34-3)14-20(23)8-10-32(25)30(37)38;/h13-16,18,21,24-25H,6-12,17H2,1-5H3,(H,37,38);/q;+1/p-1/t18-,21+,24-,25+;/m0./s1 |
| InChIKey | BFSUQRXCGZLFGC-CHHHCJMRSA-M |
| XLogP | 2.49 |
| TPSA | 43.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.78 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|