C38H57N3O2S — CID 90179816
1-[(3-ethyl-9,10-dimethyl-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl)methyl]-6,7-dimethoxy-N-octyl-3,4-dihydro-1H-isoquinoline-2-carbothioamide (PubChem CID 90179816) has the molecular formula C38H57N3O2S and a molecular weight of 619.96 g/mol. Its IUPAC name is 1-[(3-ethyl-9,10-dimethyl-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl)methyl]-6,7-dimethoxy-N-octyl-3,4-dihydro-1H-isoquinoline-2-carbothioamide.
| Compound Name | 1-[(3-ethyl-9,10-dimethyl-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl)methyl]-6,7-dimethoxy-N-octyl-3,4-dihydro-1H-isoquinoline-2-carbothioamide |
|---|---|
| PubChem CID | 90179816 |
| Molecular Formula | C38H57N3O2S |
| Molecular Weight | 619.96 g/mol |
| Exact Mass | 619.42 |
| IUPAC Name | 1-[(3-ethyl-9,10-dimethyl-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl)methyl]-6,7-dimethoxy-N-octyl-3,4-dihydro-1H-isoquinoline-2-carbothioamide |
| SMILES | CCCCCCCCNC(=S)N1CCc2cc(OC)c(OC)cc2C1CC1CC2c3cc(C)c(C)cc3CCN2CC1CC |
| InChI | InChI=1S/C38H57N3O2S/c1-7-9-10-11-12-13-16-39-38(44)41-18-15-30-23-36(42-5)37(43-6)24-33(30)35(41)22-31-21-34-32-20-27(4)26(3)19-29(32)14-17-40(34)25-28(31)8-2/h19-20,23-24,28,31,34-35H,7-18,21-22,25H2,1-6H3,(H,39,44) |
| InChIKey | YMMHNDNEEDSTMJ-UHFFFAOYSA-N |
| XLogP | 8.49 |
| TPSA | 36.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.96 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|