C37H46ClN3O2S — CID 90179803
N-[(2-chlorophenyl)methyl]-1-[(3-ethyl-9,10-dimethyl-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl)methyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinoline-2-carbothioamide (PubChem CID 90179803) has the molecular formula C37H46ClN3O2S and a molecular weight of 632.31 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-1-[(3-ethyl-9,10-dimethyl-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl)methyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinoline-2-carbothioamide.
| Compound Name | N-[(2-chlorophenyl)methyl]-1-[(3-ethyl-9,10-dimethyl-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl)methyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinoline-2-carbothioamide |
|---|---|
| PubChem CID | 90179803 |
| Molecular Formula | C37H46ClN3O2S |
| Molecular Weight | 632.31 g/mol |
| Exact Mass | 631.30 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-1-[(3-ethyl-9,10-dimethyl-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl)methyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinoline-2-carbothioamide |
| SMILES | CCC1CN2CCc3cc(C)c(C)cc3C2CC1CC1c2cc(OC)c(OC)cc2CCN1C(=S)NCc1ccccc1Cl |
| InChI | InChI=1S/C37H46ClN3O2S/c1-6-25-22-40-13-11-26-15-23(2)24(3)16-30(26)33(40)17-29(25)18-34-31-20-36(43-5)35(42-4)19-27(31)12-14-41(34)37(44)39-21-28-9-7-8-10-32(28)38/h7-10,15-16,19-20,25,29,33-34H,6,11-14,17-18,21-22H2,1-5H3,(H,39,44) |
| InChIKey | VGTPAVGAVNFDAM-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 36.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.31 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|