C37H47N3O6 — CID 130192539
(4-aminophenyl)methyl 4-(3-ethyl-9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl)-7,8-dimethoxy-1,2,4,5-tetrahydro-3-benzazepine-3-carboxylate (PubChem CID 130192539) has the molecular formula C37H47N3O6 and a molecular weight of 629.80 g/mol. Its IUPAC name is (4-aminophenyl)methyl 4-(3-ethyl-9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl)-7,8-dimethoxy-1,2,4,5-tetrahydro-3-benzazepine-3-carboxylate.
| Compound Name | (4-aminophenyl)methyl 4-(3-ethyl-9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl)-7,8-dimethoxy-1,2,4,5-tetrahydro-3-benzazepine-3-carboxylate |
|---|---|
| PubChem CID | 130192539 |
| Molecular Formula | C37H47N3O6 |
| Molecular Weight | 629.80 g/mol |
| Exact Mass | 629.35 |
| IUPAC Name | (4-aminophenyl)methyl 4-(3-ethyl-9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl)-7,8-dimethoxy-1,2,4,5-tetrahydro-3-benzazepine-3-carboxylate |
| SMILES | CCC1CN2CCc3cc(OC)c(OC)cc3C2CC1C1Cc2cc(OC)c(OC)cc2CCN1C(=O)OCc1ccc(N)cc1 |
| InChI | InChI=1S/C37H47N3O6/c1-6-24-21-39-13-11-26-17-34(43-3)36(45-5)20-30(26)31(39)19-29(24)32-15-27-18-35(44-4)33(42-2)16-25(27)12-14-40(32)37(41)46-22-23-7-9-28(38)10-8-23/h7-10,16-18,20,24,29,31-32H,6,11-15,19,21-22,38H2,1-5H3 |
| InChIKey | AMNCDGWVOGPQKN-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 95.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.80 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|