C37H47N3O5 — CID 137414751
N-benzyl-4-(3-ethyl-9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl)-7,8-dimethoxy-1,2,4,5-tetrahydro-3-benzazepine-3-carboxamide (PubChem CID 137414751) has the molecular formula C37H47N3O5 and a molecular weight of 613.80 g/mol. Its IUPAC name is N-benzyl-4-(3-ethyl-9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl)-7,8-dimethoxy-1,2,4,5-tetrahydro-3-benzazepine-3-carboxamide.
| Compound Name | N-benzyl-4-(3-ethyl-9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl)-7,8-dimethoxy-1,2,4,5-tetrahydro-3-benzazepine-3-carboxamide |
|---|---|
| PubChem CID | 137414751 |
| Molecular Formula | C37H47N3O5 |
| Molecular Weight | 613.80 g/mol |
| Exact Mass | 613.35 |
| IUPAC Name | N-benzyl-4-(3-ethyl-9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl)-7,8-dimethoxy-1,2,4,5-tetrahydro-3-benzazepine-3-carboxamide |
| SMILES | CCC1CN2CCc3cc(OC)c(OC)cc3C2CC1C1Cc2cc(OC)c(OC)cc2CCN1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C37H47N3O5/c1-6-25-23-39-14-12-27-18-34(43-3)36(45-5)21-30(27)31(39)20-29(25)32-16-28-19-35(44-4)33(42-2)17-26(28)13-15-40(32)37(41)38-22-24-10-8-7-9-11-24/h7-11,17-19,21,25,29,31-32H,6,12-16,20,22-23H2,1-5H3,(H,38,41) |
| InChIKey | MGFXVUKTCGBCNQ-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 72.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.80 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |