C20H16N2O4S — CID 89449094
methyl 1-[4-[4-(5-formyloxythiadiazol-4-yl)phenyl]phenyl]cyclopropane-1-carboxylate (PubChem CID 89449094) has the molecular formula C20H16N2O4S and a molecular weight of 380.43 g/mol. Its IUPAC name is methyl 1-[4-[4-(5-formyloxythiadiazol-4-yl)phenyl]phenyl]cyclopropane-1-carboxylate.
| Compound Name | methyl 1-[4-[4-(5-formyloxythiadiazol-4-yl)phenyl]phenyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 89449094 |
| Molecular Formula | C20H16N2O4S |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | methyl 1-[4-[4-(5-formyloxythiadiazol-4-yl)phenyl]phenyl]cyclopropane-1-carboxylate |
| SMILES | COC(=O)C1(c2ccc(-c3ccc(-c4nnsc4OC=O)cc3)cc2)CC1 |
| InChI | InChI=1S/C20H16N2O4S/c1-25-19(24)20(10-11-20)16-8-6-14(7-9-16)13-2-4-15(5-3-13)17-18(26-12-23)27-22-21-17/h2-9,12H,10-11H2,1H3 |
| InChIKey | HTVWOKYKNZVENE-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|