C29H45N4O5P — CID 89449737
4-[(2R,4R)-1-cyclooctyl-2-propylpiperidin-4-yl]-N-diethoxyphosphoryl-3-oxoquinoxaline-2-carboxamide (PubChem CID 89449737) has the molecular formula C29H45N4O5P and a molecular weight of 560.68 g/mol. Its IUPAC name is 4-[(2R,4R)-1-cyclooctyl-2-propylpiperidin-4-yl]-N-diethoxyphosphoryl-3-oxoquinoxaline-2-carboxamide.
| Compound Name | 4-[(2R,4R)-1-cyclooctyl-2-propylpiperidin-4-yl]-N-diethoxyphosphoryl-3-oxoquinoxaline-2-carboxamide |
|---|---|
| PubChem CID | 89449737 |
| Molecular Formula | C29H45N4O5P |
| Molecular Weight | 560.68 g/mol |
| Exact Mass | 560.31 |
| IUPAC Name | 4-[(2R,4R)-1-cyclooctyl-2-propylpiperidin-4-yl]-N-diethoxyphosphoryl-3-oxoquinoxaline-2-carboxamide |
| SMILES | CCC[C@@H]1C[C@H](n2c(=O)c(C(=O)NP(=O)(OCC)OCC)nc3ccccc32)CCN1C1CCCCCCC1 |
| InChI | InChI=1S/C29H45N4O5P/c1-4-14-23-21-24(19-20-32(23)22-15-10-8-7-9-11-16-22)33-26-18-13-12-17-25(26)30-27(29(33)35)28(34)31-39(36,37-5-2)38-6-3/h12-13,17-18,22-24H,4-11,14-16,19-21H2,1-3H3,(H,31,34,36)/t23-,24-/m1/s1 |
| InChIKey | UGAUELIJMMSHOR-DNQXCXABSA-N |
| XLogP | 6.23 |
| TPSA | 102.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.68 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|