C33H50N4O4 — CID 90268348
(4E)-4-ethoxyimino-4-[4-[(2R,4R)-1-[(1R,3S)-3-[(2R)-2-methylbutyl]cyclohexyl]-2-propylpiperidin-4-yl]-3-oxoquinoxalin-2-yl]butanoic acid (PubChem CID 90268348) has the molecular formula C33H50N4O4 and a molecular weight of 566.79 g/mol. Its IUPAC name is (4E)-4-ethoxyimino-4-[4-[(2R,4R)-1-[(1R,3S)-3-[(2R)-2-methylbutyl]cyclohexyl]-2-propylpiperidin-4-yl]-3-oxoquinoxalin-2-yl]butanoic acid.
| Compound Name | (4E)-4-ethoxyimino-4-[4-[(2R,4R)-1-[(1R,3S)-3-[(2R)-2-methylbutyl]cyclohexyl]-2-propylpiperidin-4-yl]-3-oxoquinoxalin-2-yl]butanoic acid |
|---|---|
| PubChem CID | 90268348 |
| Molecular Formula | C33H50N4O4 |
| Molecular Weight | 566.79 g/mol |
| Exact Mass | 566.38 |
| IUPAC Name | (4E)-4-ethoxyimino-4-[4-[(2R,4R)-1-[(1R,3S)-3-[(2R)-2-methylbutyl]cyclohexyl]-2-propylpiperidin-4-yl]-3-oxoquinoxalin-2-yl]butanoic acid |
| SMILES | CCC[C@@H]1C[C@H](n2c(=O)c(/C(CCC(=O)O)=N/OCC)nc3ccccc32)CCN1[C@@H]1CCC[C@@H](C[C@H](C)CC)C1 |
| InChI | InChI=1S/C33H50N4O4/c1-5-11-25-22-27(18-19-36(25)26-13-10-12-24(21-26)20-23(4)6-2)37-30-15-9-8-14-28(30)34-32(33(37)40)29(35-41-7-3)16-17-31(38)39/h8-9,14-15,23-27H,5-7,10-13,16-22H2,1-4H3,(H,38,39)/b35-29+/t23-,24+,25-,26-,27-/m1/s1 |
| InChIKey | ODXFLYWWWWEWGN-ODLXNOLVSA-N |
| XLogP | 6.80 |
| TPSA | 97.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.79 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|