C32H44N4O4 — CID 172956015
(4E)-4-[4-[(5R)-9-[(5S)-7-ethyl-3-bicyclo[3.3.1]nonanyl]-9-azabicyclo[3.3.1]nonan-3-yl]-3-oxoquinoxalin-2-yl]-4-methoxyiminobutanoic acid (PubChem CID 172956015) has the molecular formula C32H44N4O4 and a molecular weight of 548.73 g/mol. Its IUPAC name is (4E)-4-[4-[(5R)-9-[(5S)-7-ethyl-3-bicyclo[3.3.1]nonanyl]-9-azabicyclo[3.3.1]nonan-3-yl]-3-oxoquinoxalin-2-yl]-4-methoxyiminobutanoic acid.
| Compound Name | (4E)-4-[4-[(5R)-9-[(5S)-7-ethyl-3-bicyclo[3.3.1]nonanyl]-9-azabicyclo[3.3.1]nonan-3-yl]-3-oxoquinoxalin-2-yl]-4-methoxyiminobutanoic acid |
|---|---|
| PubChem CID | 172956015 |
| Molecular Formula | C32H44N4O4 |
| Molecular Weight | 548.73 g/mol |
| Exact Mass | 548.34 |
| IUPAC Name | (4E)-4-[4-[(5R)-9-[(5S)-7-ethyl-3-bicyclo[3.3.1]nonanyl]-9-azabicyclo[3.3.1]nonan-3-yl]-3-oxoquinoxalin-2-yl]-4-methoxyiminobutanoic acid |
| SMILES | CCC1CC2CC(N3C4CCC[C@@H]3CC(n3c(=O)c(/C(CCC(=O)O)=N/OC)nc5ccccc53)C4)C[C@@H](C1)C2 |
| InChI | InChI=1S/C32H44N4O4/c1-3-20-13-21-15-22(14-20)17-25(16-21)35-23-7-6-8-24(35)19-26(18-23)36-29-10-5-4-9-27(29)33-31(32(36)39)28(34-40-2)11-12-30(37)38/h4-5,9-10,20-26H,3,6-8,11-19H2,1-2H3,(H,37,38)/b34-28+/t20?,21-,22?,23+,24?,25?,26?/m0/s1 |
| InChIKey | NROUGPLUXHIURK-FODVVMKKSA-N |
| XLogP | 5.77 |
| TPSA | 97.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.73 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|