C30H40N4O5 — CID 90255239
(4E)-4-[4-[(1S,5R)-9-(8-bicyclo[4.3.1]decanyl)-3-oxa-9-azabicyclo[3.3.1]nonan-7-yl]-3-oxoquinoxalin-2-yl]-4-methoxyiminobutanoic acid (PubChem CID 90255239) has the molecular formula C30H40N4O5 and a molecular weight of 536.67 g/mol. Its IUPAC name is (4E)-4-[4-[(1S,5R)-9-(8-bicyclo[4.3.1]decanyl)-3-oxa-9-azabicyclo[3.3.1]nonan-7-yl]-3-oxoquinoxalin-2-yl]-4-methoxyiminobutanoic acid.
| Compound Name | (4E)-4-[4-[(1S,5R)-9-(8-bicyclo[4.3.1]decanyl)-3-oxa-9-azabicyclo[3.3.1]nonan-7-yl]-3-oxoquinoxalin-2-yl]-4-methoxyiminobutanoic acid |
|---|---|
| PubChem CID | 90255239 |
| Molecular Formula | C30H40N4O5 |
| Molecular Weight | 536.67 g/mol |
| Exact Mass | 536.30 |
| IUPAC Name | (4E)-4-[4-[(1S,5R)-9-(8-bicyclo[4.3.1]decanyl)-3-oxa-9-azabicyclo[3.3.1]nonan-7-yl]-3-oxoquinoxalin-2-yl]-4-methoxyiminobutanoic acid |
| SMILES | CO/N=C(\CCC(=O)O)c1nc2ccccc2n(C2C[C@H]3COC[C@@H](C2)N3C2CC3CCCCC(C3)C2)c1=O |
| InChI | InChI=1S/C30H40N4O5/c1-38-32-26(10-11-28(35)36)29-30(37)34(27-9-5-4-8-25(27)31-29)22-15-23-17-39-18-24(16-22)33(23)21-13-19-6-2-3-7-20(12-19)14-21/h4-5,8-9,19-24H,2-3,6-7,10-18H2,1H3,(H,35,36)/b32-26+/t19?,20?,21?,22?,23-,24+ |
| InChIKey | IFTFDGXVGXNYOI-XHCHDXSQSA-N |
| XLogP | 4.38 |
| TPSA | 106.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.67 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|