C32H44N4O4 — CID 123711252
ethyl 4-[4-[(1R,5S)-8-(8-bicyclo[4.3.1]decanyl)-8-azabicyclo[3.2.1]octan-3-yl]-3-oxoquinoxalin-2-yl]-4-methoxyiminobutanoate (PubChem CID 123711252) has the molecular formula C32H44N4O4 and a molecular weight of 548.73 g/mol. Its IUPAC name is ethyl 4-[4-[(1R,5S)-8-(8-bicyclo[4.3.1]decanyl)-8-azabicyclo[3.2.1]octan-3-yl]-3-oxoquinoxalin-2-yl]-4-methoxyiminobutanoate.
| Compound Name | ethyl 4-[4-[(1R,5S)-8-(8-bicyclo[4.3.1]decanyl)-8-azabicyclo[3.2.1]octan-3-yl]-3-oxoquinoxalin-2-yl]-4-methoxyiminobutanoate |
|---|---|
| PubChem CID | 123711252 |
| Molecular Formula | C32H44N4O4 |
| Molecular Weight | 548.73 g/mol |
| Exact Mass | 548.34 |
| IUPAC Name | ethyl 4-[4-[(1R,5S)-8-(8-bicyclo[4.3.1]decanyl)-8-azabicyclo[3.2.1]octan-3-yl]-3-oxoquinoxalin-2-yl]-4-methoxyiminobutanoate |
| SMILES | CCOC(=O)CCC(=NOC)c1nc2ccccc2n(C2C[C@H]3CC[C@@H](C2)N3C2CC3CCCCC(C3)C2)c1=O |
| InChI | InChI=1S/C32H44N4O4/c1-3-40-30(37)15-14-28(34-39-2)31-32(38)36(29-11-7-6-10-27(29)33-31)26-19-23-12-13-24(20-26)35(23)25-17-21-8-4-5-9-22(16-21)18-25/h6-7,10-11,21-26H,3-5,8-9,12-20H2,1-2H3/t21?,22?,23-,24+,25?,26? |
| InChIKey | ZKIOQTNGBTVZOA-HXDSAGKHSA-N |
| XLogP | 5.62 |
| TPSA | 86.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.73 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|