C31H42N4O4 — CID 90255238
ethyl 4-[4-[(5R)-8-(3-bicyclo[3.3.1]nonanyl)-8-azabicyclo[3.2.1]octan-3-yl]-3-oxoquinoxalin-2-yl]-4-methoxyiminobutanoate (PubChem CID 90255238) has the molecular formula C31H42N4O4 and a molecular weight of 534.70 g/mol. Its IUPAC name is ethyl 4-[4-[(5R)-8-(3-bicyclo[3.3.1]nonanyl)-8-azabicyclo[3.2.1]octan-3-yl]-3-oxoquinoxalin-2-yl]-4-methoxyiminobutanoate.
| Compound Name | ethyl 4-[4-[(5R)-8-(3-bicyclo[3.3.1]nonanyl)-8-azabicyclo[3.2.1]octan-3-yl]-3-oxoquinoxalin-2-yl]-4-methoxyiminobutanoate |
|---|---|
| PubChem CID | 90255238 |
| Molecular Formula | C31H42N4O4 |
| Molecular Weight | 534.70 g/mol |
| Exact Mass | 534.32 |
| IUPAC Name | ethyl 4-[4-[(5R)-8-(3-bicyclo[3.3.1]nonanyl)-8-azabicyclo[3.2.1]octan-3-yl]-3-oxoquinoxalin-2-yl]-4-methoxyiminobutanoate |
| SMILES | CCOC(=O)CCC(=NOC)c1nc2ccccc2n(C2CC3CC[C@H](C2)N3C2CC3CCCC(C3)C2)c1=O |
| InChI | InChI=1S/C31H42N4O4/c1-3-39-29(36)14-13-27(33-38-2)30-31(37)35(28-10-5-4-9-26(28)32-30)25-18-22-11-12-23(19-25)34(22)24-16-20-7-6-8-21(15-20)17-24/h4-5,9-10,20-25H,3,6-8,11-19H2,1-2H3/t20?,21?,22-,23?,24?,25?/m1/s1 |
| InChIKey | OHZULCAZEWDJCO-GCQVQTGRSA-N |
| XLogP | 5.23 |
| TPSA | 86.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.70 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|