C34H47N5O5 — CID 123194430
ethyl 4-(2-amino-2-oxoethoxy)imino-4-[4-[9-(8-bicyclo[4.3.1]decanyl)-9-azabicyclo[3.3.1]nonan-3-yl]-3-oxoquinoxalin-2-yl]butanoate (PubChem CID 123194430) has the molecular formula C34H47N5O5 and a molecular weight of 605.78 g/mol. Its IUPAC name is ethyl 4-(2-amino-2-oxoethoxy)imino-4-[4-[9-(8-bicyclo[4.3.1]decanyl)-9-azabicyclo[3.3.1]nonan-3-yl]-3-oxoquinoxalin-2-yl]butanoate.
| Compound Name | ethyl 4-(2-amino-2-oxoethoxy)imino-4-[4-[9-(8-bicyclo[4.3.1]decanyl)-9-azabicyclo[3.3.1]nonan-3-yl]-3-oxoquinoxalin-2-yl]butanoate |
|---|---|
| PubChem CID | 123194430 |
| Molecular Formula | C34H47N5O5 |
| Molecular Weight | 605.78 g/mol |
| Exact Mass | 605.36 |
| IUPAC Name | ethyl 4-(2-amino-2-oxoethoxy)imino-4-[4-[9-(8-bicyclo[4.3.1]decanyl)-9-azabicyclo[3.3.1]nonan-3-yl]-3-oxoquinoxalin-2-yl]butanoate |
| SMILES | CCOC(=O)CCC(=NOCC(N)=O)c1nc2ccccc2n(C2CC3CCCC(C2)N3C2CC3CCCCC(C3)C2)c1=O |
| InChI | InChI=1S/C34H47N5O5/c1-2-43-32(41)15-14-29(37-44-21-31(35)40)33-34(42)39(30-13-6-5-12-28(30)36-33)27-19-24-10-7-11-25(20-27)38(24)26-17-22-8-3-4-9-23(16-22)18-26/h5-6,12-13,22-27H,2-4,7-11,14-21H2,1H3,(H2,35,40) |
| InChIKey | HFEUCQSWSSEQOM-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 129.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.78 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|