C30H43N5O4 — CID 90268227
(4E)-4-(2-aminoethoxyimino)-4-[4-[1-[(1R,5S)-7-ethyl-3-bicyclo[3.3.1]nonanyl]piperidin-4-yl]-3-oxoquinoxalin-2-yl]butanoic acid (PubChem CID 90268227) has the molecular formula C30H43N5O4 and a molecular weight of 537.71 g/mol. Its IUPAC name is (4E)-4-(2-aminoethoxyimino)-4-[4-[1-[(1R,5S)-7-ethyl-3-bicyclo[3.3.1]nonanyl]piperidin-4-yl]-3-oxoquinoxalin-2-yl]butanoic acid.
| Compound Name | (4E)-4-(2-aminoethoxyimino)-4-[4-[1-[(1R,5S)-7-ethyl-3-bicyclo[3.3.1]nonanyl]piperidin-4-yl]-3-oxoquinoxalin-2-yl]butanoic acid |
|---|---|
| PubChem CID | 90268227 |
| Molecular Formula | C30H43N5O4 |
| Molecular Weight | 537.71 g/mol |
| Exact Mass | 537.33 |
| IUPAC Name | (4E)-4-(2-aminoethoxyimino)-4-[4-[1-[(1R,5S)-7-ethyl-3-bicyclo[3.3.1]nonanyl]piperidin-4-yl]-3-oxoquinoxalin-2-yl]butanoic acid |
| SMILES | CCC1C[C@@H]2CC(N3CCC(n4c(=O)c(/C(CCC(=O)O)=N/OCCN)nc5ccccc54)CC3)C[C@H](C1)C2 |
| InChI | InChI=1S/C30H43N5O4/c1-2-20-15-21-17-22(16-20)19-24(18-21)34-12-9-23(10-13-34)35-27-6-4-3-5-25(27)32-29(30(35)38)26(7-8-28(36)37)33-39-14-11-31/h3-6,20-24H,2,7-19,31H2,1H3,(H,36,37)/b33-26+/t20?,21-,22+,24? |
| InChIKey | YQGIMDJZVAYVEQ-PLHJBQLNSA-N |
| XLogP | 4.18 |
| TPSA | 123.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.71 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|