C37H57N5O4 — CID 118098202
(4E)-4-[2-(diethylamino)ethoxyimino]-4-[3-oxo-4-[(1R,5S)-9-[(3R,7S)-3,5,7-trimethylcyclooctyl]-9-azabicyclo[3.3.1]nonan-3-yl]quinoxalin-2-yl]butanoic acid (PubChem CID 118098202) has the molecular formula C37H57N5O4 and a molecular weight of 635.89 g/mol. Its IUPAC name is (4E)-4-[2-(diethylamino)ethoxyimino]-4-[3-oxo-4-[(1R,5S)-9-[(3R,7S)-3,5,7-trimethylcyclooctyl]-9-azabicyclo[3.3.1]nonan-3-yl]quinoxalin-2-yl]butanoic acid.
| Compound Name | (4E)-4-[2-(diethylamino)ethoxyimino]-4-[3-oxo-4-[(1R,5S)-9-[(3R,7S)-3,5,7-trimethylcyclooctyl]-9-azabicyclo[3.3.1]nonan-3-yl]quinoxalin-2-yl]butanoic acid |
|---|---|
| PubChem CID | 118098202 |
| Molecular Formula | C37H57N5O4 |
| Molecular Weight | 635.89 g/mol |
| Exact Mass | 635.44 |
| IUPAC Name | (4E)-4-[2-(diethylamino)ethoxyimino]-4-[3-oxo-4-[(1R,5S)-9-[(3R,7S)-3,5,7-trimethylcyclooctyl]-9-azabicyclo[3.3.1]nonan-3-yl]quinoxalin-2-yl]butanoic acid |
| SMILES | CCN(CC)CCO/N=C(\CCC(=O)O)c1nc2ccccc2n(C2C[C@H]3CCC[C@@H](C2)N3C2C[C@H](C)CC(C)C[C@H](C)C2)c1=O |
| InChI | InChI=1S/C37H57N5O4/c1-6-40(7-2)17-18-46-39-33(15-16-35(43)44)36-37(45)42(34-14-9-8-13-32(34)38-36)31-23-28-11-10-12-29(24-31)41(28)30-21-26(4)19-25(3)20-27(5)22-30/h8-9,13-14,25-31H,6-7,10-12,15-24H2,1-5H3,(H,43,44)/b39-33+/t25?,26-,27+,28-,29+,30?,31? |
| InChIKey | NVQYEODKGHWUIL-ULQWLHHZSA-N |
| XLogP | 6.73 |
| TPSA | 100.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.89 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|