C35H51N5O4 — CID 144657753
(4E)-4-[4-[9-(5,6-diethyl-3-bicyclo[4.1.0]heptanyl)-9-azabicyclo[3.3.1]nonan-3-yl]-3-oxoquinoxalin-2-yl]-4-[2-(dimethylamino)ethoxyimino]butanoic acid (PubChem CID 144657753) has the molecular formula C35H51N5O4 and a molecular weight of 605.82 g/mol. Its IUPAC name is (4E)-4-[4-[9-(5,6-diethyl-3-bicyclo[4.1.0]heptanyl)-9-azabicyclo[3.3.1]nonan-3-yl]-3-oxoquinoxalin-2-yl]-4-[2-(dimethylamino)ethoxyimino]butanoic acid.
| Compound Name | (4E)-4-[4-[9-(5,6-diethyl-3-bicyclo[4.1.0]heptanyl)-9-azabicyclo[3.3.1]nonan-3-yl]-3-oxoquinoxalin-2-yl]-4-[2-(dimethylamino)ethoxyimino]butanoic acid |
|---|---|
| PubChem CID | 144657753 |
| Molecular Formula | C35H51N5O4 |
| Molecular Weight | 605.82 g/mol |
| Exact Mass | 605.39 |
| IUPAC Name | (4E)-4-[4-[9-(5,6-diethyl-3-bicyclo[4.1.0]heptanyl)-9-azabicyclo[3.3.1]nonan-3-yl]-3-oxoquinoxalin-2-yl]-4-[2-(dimethylamino)ethoxyimino]butanoic acid |
| SMILES | CCC1CC(N2C3CCCC2CC(n2c(=O)c(/C(CCC(=O)O)=N/OCCN(C)C)nc4ccccc42)C3)CC2CC12CC |
| InChI | InChI=1S/C35H51N5O4/c1-5-23-18-27(19-24-22-35(23,24)6-2)39-25-10-9-11-26(39)21-28(20-25)40-31-13-8-7-12-29(31)36-33(34(40)43)30(14-15-32(41)42)37-44-17-16-38(3)4/h7-8,12-13,23-28H,5-6,9-11,14-22H2,1-4H3,(H,41,42)/b37-30+ |
| InChIKey | GFLAPDMTCRRITP-GGFUHWEBSA-N |
| XLogP | 5.71 |
| TPSA | 100.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.82 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|