C26H18N4O4 — CID 89451156
N-(1,3-benzodioxol-5-yl)-5-(5-phenoxy-3-pyridinyl)-1H-indazole-3-carboxamide (PubChem CID 89451156) has the molecular formula C26H18N4O4 and a molecular weight of 450.45 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-5-(5-phenoxy-3-pyridinyl)-1H-indazole-3-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-5-(5-phenoxy-3-pyridinyl)-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 89451156 |
| Molecular Formula | C26H18N4O4 |
| Molecular Weight | 450.45 g/mol |
| Exact Mass | 450.13 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-5-(5-phenoxy-3-pyridinyl)-1H-indazole-3-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)OCO2)c1n[nH]c2ccc(-c3cncc(Oc4ccccc4)c3)cc12 |
| InChI | InChI=1S/C26H18N4O4/c31-26(28-18-7-9-23-24(12-18)33-15-32-23)25-21-11-16(6-8-22(21)29-30-25)17-10-20(14-27-13-17)34-19-4-2-1-3-5-19/h1-14H,15H2,(H,28,31)(H,29,30) |
| InChIKey | AKLAOLOCMMHXMO-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 98.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.45 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |