C18H17FN4S — CID 89452214
N-[(2-fluorophenyl)methyl]-3,10,12-trimethyl-7-thia-3,4,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaen-5-amine (PubChem CID 89452214) has the molecular formula C18H17FN4S and a molecular weight of 340.43 g/mol. Its IUPAC name is N-[(2-fluorophenyl)methyl]-3,10,12-trimethyl-7-thia-3,4,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaen-5-amine.
| Compound Name | N-[(2-fluorophenyl)methyl]-3,10,12-trimethyl-7-thia-3,4,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaen-5-amine |
|---|---|
| PubChem CID | 89452214 |
| Molecular Formula | C18H17FN4S |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | N-[(2-fluorophenyl)methyl]-3,10,12-trimethyl-7-thia-3,4,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaen-5-amine |
| SMILES | Cc1cc(C)c2c(n1)sc1c(NCc3ccccc3F)nn(C)c12 |
| InChI | InChI=1S/C18H17FN4S/c1-10-8-11(2)21-18-14(10)15-16(24-18)17(22-23(15)3)20-9-12-6-4-5-7-13(12)19/h4-8H,9H2,1-3H3,(H,20,22) |
| InChIKey | BMQXYOVPPDBQKM-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |