C18H26N2O8 — CID 89453005
2,6-bis[2-(2-hydroxyethoxy)ethyl]-3a,4,4a,7a,8,8a-hexahydropyrrolo[3,4-f]isoindole-1,3,5,7-tetrone (PubChem CID 89453005) has the molecular formula C18H26N2O8 and a molecular weight of 398.41 g/mol. Its IUPAC name is 2,6-bis[2-(2-hydroxyethoxy)ethyl]-3a,4,4a,7a,8,8a-hexahydropyrrolo[3,4-f]isoindole-1,3,5,7-tetrone.
| Compound Name | 2,6-bis[2-(2-hydroxyethoxy)ethyl]-3a,4,4a,7a,8,8a-hexahydropyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
|---|---|
| PubChem CID | 89453005 |
| Molecular Formula | C18H26N2O8 |
| Molecular Weight | 398.41 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | 2,6-bis[2-(2-hydroxyethoxy)ethyl]-3a,4,4a,7a,8,8a-hexahydropyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
| SMILES | O=C1C2CC3C(=O)N(CCOCCO)C(=O)C3CC2C(=O)N1CCOCCO |
| InChI | InChI=1S/C18H26N2O8/c21-3-7-27-5-1-19-15(23)11-9-13-14(10-12(11)16(19)24)18(26)20(17(13)25)2-6-28-8-4-22/h11-14,21-22H,1-10H2 |
| InChIKey | JEEACCMPCOSEFN-UHFFFAOYSA-N |
| XLogP | -2.00 |
| TPSA | 133.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.41 |
| LogP ≤ 5 | -2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|