C8H14N2O4 — CID 66063429
1-[2-(2-hydroxyethoxy)ethyl]piperazine-2,6-dione (PubChem CID 66063429) has the molecular formula C8H14N2O4 and a molecular weight of 202.21 g/mol. Its IUPAC name is 1-[2-(2-hydroxyethoxy)ethyl]piperazine-2,6-dione.
| Compound Name | 1-[2-(2-hydroxyethoxy)ethyl]piperazine-2,6-dione |
|---|---|
| PubChem CID | 66063429 |
| Molecular Formula | C8H14N2O4 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | 1-[2-(2-hydroxyethoxy)ethyl]piperazine-2,6-dione |
| SMILES | O=C1CNCC(=O)N1CCOCCO |
| InChI | InChI=1S/C8H14N2O4/c11-2-4-14-3-1-10-7(12)5-9-6-8(10)13/h9,11H,1-6H2 |
| InChIKey | GOKBSTBXXHQNRC-UHFFFAOYSA-N |
| XLogP | -2.05 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | -2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|