C7H11ClN2O2 — CID 21245750
1-(3-chloropropyl)piperazine-2,6-dione (PubChem CID 21245750) has the molecular formula C7H11ClN2O2 and a molecular weight of 190.63 g/mol. Its IUPAC name is 1-(3-chloropropyl)piperazine-2,6-dione.
| Compound Name | 1-(3-chloropropyl)piperazine-2,6-dione |
|---|---|
| PubChem CID | 21245750 |
| Molecular Formula | C7H11ClN2O2 |
| Molecular Weight | 190.63 g/mol |
| Exact Mass | 190.05 |
| IUPAC Name | 1-(3-chloropropyl)piperazine-2,6-dione |
| SMILES | O=C1CNCC(=O)N1CCCCl |
| InChI | InChI=1S/C7H11ClN2O2/c8-2-1-3-10-6(11)4-9-5-7(10)12/h9H,1-5H2 |
| InChIKey | PFIXBMZZMFKIIZ-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.63 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|