C33H29N5O3 — CID 89454732
2-(2,3-dihydroxyphenyl)-2-methyl-N-[[4-(3-methyl-9-phenyl-[1,2,4]triazolo[3,4-f][1,6]naphthyridin-8-yl)phenyl]methyl]propanamide (PubChem CID 89454732) has the molecular formula C33H29N5O3 and a molecular weight of 543.63 g/mol. Its IUPAC name is 2-(2,3-dihydroxyphenyl)-2-methyl-N-[[4-(3-methyl-9-phenyl-[1,2,4]triazolo[3,4-f][1,6]naphthyridin-8-yl)phenyl]methyl]propanamide.
| Compound Name | 2-(2,3-dihydroxyphenyl)-2-methyl-N-[[4-(3-methyl-9-phenyl-[1,2,4]triazolo[3,4-f][1,6]naphthyridin-8-yl)phenyl]methyl]propanamide |
|---|---|
| PubChem CID | 89454732 |
| Molecular Formula | C33H29N5O3 |
| Molecular Weight | 543.63 g/mol |
| Exact Mass | 543.23 |
| IUPAC Name | 2-(2,3-dihydroxyphenyl)-2-methyl-N-[[4-(3-methyl-9-phenyl-[1,2,4]triazolo[3,4-f][1,6]naphthyridin-8-yl)phenyl]methyl]propanamide |
| SMILES | Cc1nnc2c3cc(-c4ccccc4)c(-c4ccc(CNC(=O)C(C)(C)c5cccc(O)c5O)cc4)nc3ccn12 |
| InChI | InChI=1S/C33H29N5O3/c1-20-36-37-31-25-18-24(22-8-5-4-6-9-22)29(35-27(25)16-17-38(20)31)23-14-12-21(13-15-23)19-34-32(41)33(2,3)26-10-7-11-28(39)30(26)40/h4-18,39-40H,19H2,1-3H3,(H,34,41) |
| InChIKey | DFBJBJFWNFPYEN-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 112.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.63 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|