C70H106O16 — CID 89454801
[1-[3-[2,3-bis[2-(2-ethylbutanoyloxy)octanoyl]benzoyl]peroxycarbonyl-2-[2-(2-ethylbutanoyloxy)octanoyl]phenyl]-1-oxooctan-2-yl] 2-ethylbutanoate (PubChem CID 89454801) has the molecular formula C70H106O16 and a molecular weight of 1203.60 g/mol. Its IUPAC name is [1-[3-[2,3-bis[2-(2-ethylbutanoyloxy)octanoyl]benzoyl]peroxycarbonyl-2-[2-(2-ethylbutanoyloxy)octanoyl]phenyl]-1-oxooctan-2-yl] 2-ethylbutanoate.
| Compound Name | [1-[3-[2,3-bis[2-(2-ethylbutanoyloxy)octanoyl]benzoyl]peroxycarbonyl-2-[2-(2-ethylbutanoyloxy)octanoyl]phenyl]-1-oxooctan-2-yl] 2-ethylbutanoate |
|---|---|
| PubChem CID | 89454801 |
| Molecular Formula | C70H106O16 |
| Molecular Weight | 1203.60 g/mol |
| Exact Mass | 1202.75 |
| IUPAC Name | [1-[3-[2,3-bis[2-(2-ethylbutanoyloxy)octanoyl]benzoyl]peroxycarbonyl-2-[2-(2-ethylbutanoyloxy)octanoyl]phenyl]-1-oxooctan-2-yl] 2-ethylbutanoate |
| SMILES | CCCCCCC(OC(=O)C(CC)CC)C(=O)c1cccc(C(=O)OOC(=O)c2cccc(C(=O)C(CCCCCC)OC(=O)C(CC)CC)c2C(=O)C(CCCCCC)OC(=O)C(CC)CC)c1C(=O)C(CCCCCC)OC(=O)C(CC)CC |
| InChI | InChI=1S/C70H106O16/c1-13-25-29-33-43-55(81-65(75)47(17-5)18-6)61(71)51-39-37-41-53(59(51)63(73)57(45-35-31-27-15-3)83-67(77)49(21-9)22-10)69(79)85-86-70(80)54-42-38-40-52(62(72)56(44-34-30-26-14-2)82-66(76)48(19-7)20-8)60(54)64(74)58(46-36-32-28-16-4)84-68(78)50(23-11)24-12/h37-42,47-50,55-58H,13-36,43-46H2,1-12H3 |
| InChIKey | BJVYXXBBEKFEEW-UHFFFAOYSA-N |
| XLogP | 16.62 |
| TPSA | 226.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 46 |
| Heavy Atoms | 86 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1203.60 |
| LogP ≤ 5 | 16.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|