C10H10F2O5S — CID 89457691
[1,1-difluoro-1-(trioxidanylsulfanyl)propan-2-yl] benzoate (PubChem CID 89457691) has the molecular formula C10H10F2O5S and a molecular weight of 280.25 g/mol. Its IUPAC name is [1,1-difluoro-1-(trioxidanylsulfanyl)propan-2-yl] benzoate.
| Compound Name | [1,1-difluoro-1-(trioxidanylsulfanyl)propan-2-yl] benzoate |
|---|---|
| PubChem CID | 89457691 |
| Molecular Formula | C10H10F2O5S |
| Molecular Weight | 280.25 g/mol |
| Exact Mass | 280.02 |
| IUPAC Name | [1,1-difluoro-1-(trioxidanylsulfanyl)propan-2-yl] benzoate |
| SMILES | CC(OC(=O)c1ccccc1)C(F)(F)SOOO |
| InChI | InChI=1S/C10H10F2O5S/c1-7(10(11,12)18-17-16-14)15-9(13)8-5-3-2-4-6-8/h2-7,14H,1H3 |
| InChIKey | GRVQBCHYDXYGKH-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.25 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|