C7H12FNO4S — CID 89457827
1-fluoro-2-oxo-2-piperidin-1-ylethanesulfonic acid (PubChem CID 89457827) has the molecular formula C7H12FNO4S and a molecular weight of 225.24 g/mol. Its IUPAC name is 1-fluoro-2-oxo-2-piperidin-1-ylethanesulfonic acid.
| Compound Name | 1-fluoro-2-oxo-2-piperidin-1-ylethanesulfonic acid |
|---|---|
| PubChem CID | 89457827 |
| Molecular Formula | C7H12FNO4S |
| Molecular Weight | 225.24 g/mol |
| Exact Mass | 225.05 |
| IUPAC Name | 1-fluoro-2-oxo-2-piperidin-1-ylethanesulfonic acid |
| SMILES | O=C(C(F)S(=O)(=O)O)N1CCCCC1 |
| InChI | InChI=1S/C7H12FNO4S/c8-6(14(11,12)13)7(10)9-4-2-1-3-5-9/h6H,1-5H2,(H,11,12,13) |
| InChIKey | LHLWTUJZPXECJY-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.24 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|