C13H25NO2 — CID 89459386
N-(2,6-dimethyl-3-oxoheptan-4-yl)-2-methylpropan(18O)amide (PubChem CID 89459386) has the molecular formula C13H25NO2 and a molecular weight of 229.35 g/mol. Its IUPAC name is N-(2,6-dimethyl-3-oxoheptan-4-yl)-2-methylpropan(18O)amide.
| Compound Name | N-(2,6-dimethyl-3-oxoheptan-4-yl)-2-methylpropan(18O)amide |
|---|---|
| PubChem CID | 89459386 |
| Molecular Formula | C13H25NO2 |
| Molecular Weight | 229.35 g/mol |
| Exact Mass | 229.19 |
| IUPAC Name | N-(2,6-dimethyl-3-oxoheptan-4-yl)-2-methylpropan(18O)amide |
| SMILES | CC(C)CC(NC(=[18O])C(C)C)C(=O)C(C)C |
| InChI | InChI=1S/C13H25NO2/c1-8(2)7-11(12(15)9(3)4)14-13(16)10(5)6/h8-11H,7H2,1-6H3,(H,14,16)/i16+2 |
| InChIKey | LHKFHBBGCIIGPF-VPMSBSONSA-N |
| XLogP | 2.40 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.35 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |