C42H52N2S — CID 89461203
2-[(E)-2-[(3E)-2-(4-tert-butylphenyl)sulfanyl-3-[(2E)-2-(1,3,3-trimethyl-4,5-dihydroindol-2-ylidene)ethylidene]cyclohexen-1-yl]ethenyl]-1,3,3-trimethyl-2H-indole (PubChem CID 89461203) has the molecular formula C42H52N2S and a molecular weight of 616.96 g/mol. Its IUPAC name is 2-[(E)-2-[(3E)-2-(4-tert-butylphenyl)sulfanyl-3-[(2E)-2-(1,3,3-trimethyl-4,5-dihydroindol-2-ylidene)ethylidene]cyclohexen-1-yl]ethenyl]-1,3,3-trimethyl-2H-indole.
| Compound Name | 2-[(E)-2-[(3E)-2-(4-tert-butylphenyl)sulfanyl-3-[(2E)-2-(1,3,3-trimethyl-4,5-dihydroindol-2-ylidene)ethylidene]cyclohexen-1-yl]ethenyl]-1,3,3-trimethyl-2H-indole |
|---|---|
| PubChem CID | 89461203 |
| Molecular Formula | C42H52N2S |
| Molecular Weight | 616.96 g/mol |
| Exact Mass | 616.39 |
| IUPAC Name | 2-[(E)-2-[(3E)-2-(4-tert-butylphenyl)sulfanyl-3-[(2E)-2-(1,3,3-trimethyl-4,5-dihydroindol-2-ylidene)ethylidene]cyclohexen-1-yl]ethenyl]-1,3,3-trimethyl-2H-indole |
| SMILES | CN1C2=C(CCC=C2)C(C)(C)/C1=C\C=C1/CCCC(/C=C/C2N(C)c3ccccc3C2(C)C)=C1Sc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C42H52N2S/c1-40(2,3)31-23-25-32(26-24-31)45-39-29(21-27-37-41(4,5)33-17-10-12-19-35(33)43(37)8)15-14-16-30(39)22-28-38-42(6,7)34-18-11-13-20-36(34)44(38)9/h10,12-13,17,19-28,37H,11,14-16,18H2,1-9H3/b27-21+,30-22+,38-28+ |
| InChIKey | GZGWUWUSIJUMSV-INCCNGJHSA-N |
| XLogP | 11.25 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.96 |
| LogP ≤ 5 | 11.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |