C25H22ClF3N4O2 — CID 89463727
6-amino-N-[4-[[3-[[6-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]methylidene]cyclohexyl]pyridine-3-carboxamide (PubChem CID 89463727) has the molecular formula C25H22ClF3N4O2 and a molecular weight of 502.92 g/mol. Its IUPAC name is 6-amino-N-[4-[[3-[[6-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]methylidene]cyclohexyl]pyridine-3-carboxamide.
| Compound Name | 6-amino-N-[4-[[3-[[6-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]methylidene]cyclohexyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 89463727 |
| Molecular Formula | C25H22ClF3N4O2 |
| Molecular Weight | 502.92 g/mol |
| Exact Mass | 502.14 |
| IUPAC Name | 6-amino-N-[4-[[3-[[6-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]methylidene]cyclohexyl]pyridine-3-carboxamide |
| SMILES | Nc1ccc(C(=O)NC2CCC(=Cc3cccc(Oc4ccc(C(F)(F)F)c(Cl)n4)c3)CC2)cn1 |
| InChI | InChI=1S/C25H22ClF3N4O2/c26-23-20(25(27,28)29)9-11-22(33-23)35-19-3-1-2-16(13-19)12-15-4-7-18(8-5-15)32-24(34)17-6-10-21(30)31-14-17/h1-3,6,9-14,18H,4-5,7-8H2,(H2,30,31)(H,32,34)/b15-12- |
| InChIKey | ITYXAFVJEULGEI-QINSGFPZSA-N |
| XLogP | 6.28 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.92 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|