C21H17ClN2O3S — CID 8946583
(2R)-4-[(E)-3-(3-chloro-1-benzothiophen-2-yl)prop-2-enoyl]-N-methyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide (PubChem CID 8946583) has the molecular formula C21H17ClN2O3S and a molecular weight of 412.90 g/mol. Its IUPAC name is (2R)-4-[(E)-3-(3-chloro-1-benzothiophen-2-yl)prop-2-enoyl]-N-methyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide.
| Compound Name | (2R)-4-[(E)-3-(3-chloro-1-benzothiophen-2-yl)prop-2-enoyl]-N-methyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
|---|---|
| PubChem CID | 8946583 |
| Molecular Formula | C21H17ClN2O3S |
| Molecular Weight | 412.90 g/mol |
| Exact Mass | 412.06 |
| IUPAC Name | (2R)-4-[(E)-3-(3-chloro-1-benzothiophen-2-yl)prop-2-enoyl]-N-methyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
| SMILES | CNC(=O)[C@H]1CN(C(=O)/C=C/c2sc3ccccc3c2Cl)c2ccccc2O1 |
| InChI | InChI=1S/C21H17ClN2O3S/c1-23-21(26)16-12-24(14-7-3-4-8-15(14)27-16)19(25)11-10-18-20(22)13-6-2-5-9-17(13)28-18/h2-11,16H,12H2,1H3,(H,23,26)/b11-10+/t16-/m1/s1 |
| InChIKey | CIIZPILNCJVGKV-SIFUEBAJSA-N |
| XLogP | 4.11 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.90 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|