C21H25ClN4O3 — CID 8946204
(2S)-4-[(E)-3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)prop-2-enoyl]-N-methyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide (PubChem CID 8946204) has the molecular formula C21H25ClN4O3 and a molecular weight of 416.91 g/mol. Its IUPAC name is (2S)-4-[(E)-3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)prop-2-enoyl]-N-methyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide.
| Compound Name | (2S)-4-[(E)-3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)prop-2-enoyl]-N-methyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
|---|---|
| PubChem CID | 8946204 |
| Molecular Formula | C21H25ClN4O3 |
| Molecular Weight | 416.91 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | (2S)-4-[(E)-3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)prop-2-enoyl]-N-methyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
| SMILES | CCCCn1nc(C)c(/C=C/C(=O)N2C[C@@H](C(=O)NC)Oc3ccccc32)c1Cl |
| InChI | InChI=1S/C21H25ClN4O3/c1-4-5-12-26-20(22)15(14(2)24-26)10-11-19(27)25-13-18(21(28)23-3)29-17-9-7-6-8-16(17)25/h6-11,18H,4-5,12-13H2,1-3H3,(H,23,28)/b11-10+/t18-/m0/s1 |
| InChIKey | RMFSYARZRCRSJX-ZGKFYVQTSA-N |
| XLogP | 3.20 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.91 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|