C22H22ClF3N4O3 — CID 89466142
[(7R,8aS)-7-(5-cyclopropylpyrazin-2-yl)oxy-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-[3-chloro-5-(trifluoromethoxy)phenyl]methanone (PubChem CID 89466142) has the molecular formula C22H22ClF3N4O3 and a molecular weight of 482.89 g/mol. Its IUPAC name is [(7R,8aS)-7-(5-cyclopropylpyrazin-2-yl)oxy-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-[3-chloro-5-(trifluoromethoxy)phenyl]methanone.
| Compound Name | [(7R,8aS)-7-(5-cyclopropylpyrazin-2-yl)oxy-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-[3-chloro-5-(trifluoromethoxy)phenyl]methanone |
|---|---|
| PubChem CID | 89466142 |
| Molecular Formula | C22H22ClF3N4O3 |
| Molecular Weight | 482.89 g/mol |
| Exact Mass | 482.13 |
| IUPAC Name | [(7R,8aS)-7-(5-cyclopropylpyrazin-2-yl)oxy-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-[3-chloro-5-(trifluoromethoxy)phenyl]methanone |
| SMILES | O=C(c1cc(Cl)cc(OC(F)(F)F)c1)N1CCN2C[C@H](Oc3cnc(C4CC4)cn3)C[C@H]2C1 |
| InChI | InChI=1S/C22H22ClF3N4O3/c23-15-5-14(6-17(7-15)33-22(24,25)26)21(31)30-4-3-29-12-18(8-16(29)11-30)32-20-10-27-19(9-28-20)13-1-2-13/h5-7,9-10,13,16,18H,1-4,8,11-12H2/t16-,18+/m0/s1 |
| InChIKey | AHDXAMYGDQJDKM-FUHWJXTLSA-N |
| XLogP | 3.88 |
| TPSA | 67.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.89 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |